![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1st Skill Olympics K..> | 2025-12-19 21:49 | 20M | |
| 2 Types of Tigers.mp4 | 2025-12-19 21:49 | 14M | |
| 3D letter writing.mp4 | 2025-12-19 21:49 | 6.4M | |
| Aao bachon sair kara..> | 2025-12-19 21:49 | 11M | |
| Aap Yaha Aaey Kis Li..> | 2025-12-19 21:50 | 1.3M | |
| About Bhalai.mp4 | 2025-12-19 21:50 | 7.6M | |
| About Human Super Co..> | 2025-12-19 21:50 | 6.6M | |
| About Life.mp4 | 2025-12-19 21:50 | 3.6M | |
| About Past and Futur..> | 2025-12-19 21:50 | 5.1M | |
| About Professional L..> | 2025-12-19 21:50 | 5.8M | |
| About Sukoon.mp4 | 2025-12-19 21:50 | 3.4M | |
| About Traffic Block.mp4 | 2025-12-19 21:50 | 3.0M | |
| About stress.mp4 | 2025-12-19 21:50 | 5.1M | |
| Adeel welcome by Han..> | 2025-12-19 21:50 | 4.3M | |
| Afridi Records.mp4 | 2025-12-19 21:50 | 40M | |
| Air Craft Carrier.mp4 | 2025-12-19 21:50 | 11M | |
| Aircraft Making.mp4 | 2025-12-19 21:51 | 11M | |
| Aleem Dar Couldn't S..> | 2025-12-19 21:51 | 2.6M | |
| Ali Zafar for Amitab..> | 2025-12-19 21:51 | 8.6M | |
| Amir Liaqat about NA..> | 2025-12-19 21:51 | 20M | |
| Apni Apni Qismat.mp4 | 2025-12-19 21:51 | 3.1M | |
| Arshad Nadeem Olympi..> | 2025-12-19 21:51 | 18M | |
| Asma Jahangir expose..> | 2025-12-19 21:51 | 18M | |
| Australia v Peru - 2..> | 2025-12-19 21:51 | 36M | |
| Automatic running bi..> | 2025-12-19 21:51 | 739K | |
| Azan Makkah.mp4 | 2025-12-19 21:51 | 9.5M | |
| Bachi ka latifa.mp4 | 2025-12-19 21:52 | 4.2M | |
| Baked Beans.mp4 | 2025-12-19 21:52 | 1.8M | |
| Bandage Fixing.mp4 | 2025-12-19 21:52 | 2.5M | |
| Bangkok Train.mp4 | 2025-12-19 21:52 | 1.5M | |
| Basanti Dog Dance.mp4 | 2025-12-19 21:52 | 1.8M | |
| Behan Bhai Calculati..> | 2025-12-19 21:52 | 7.2M | |
| Belgium Netherland B..> | 2025-12-19 21:52 | 11M | |
| Best Actor of the Ye..> | 2025-12-19 21:52 | 880K | |
| Best about Namaz.mp4 | 2025-12-19 21:52 | 9.5M | |
| Boond Boond Mein.mp4 | 2025-12-19 21:52 | 5.6M | |
| Cat_MubarakBad.mp4 | 2025-12-19 21:52 | 714K | |
| Cell Repairing.mp4 | 2025-12-19 21:52 | 5.2M | |
| Channalize Energy.mp4 | 2025-12-19 21:52 | 9.2M | |
| Check Your Health in..> | 2025-12-19 21:52 | 6.9M | |
| Check your health.mp4 | 2025-12-19 21:52 | 1.2M | |
| Children Eating.mp4 | 2025-12-19 21:52 | 431K | |
| Children Education f..> | 2025-12-19 21:53 | 6.3M | |
| Children Tarbiat.mp4 | 2025-12-19 21:53 | 2.8M | |
| Children Tarbiat2.mp4 | 2025-12-19 21:53 | 11M | |
| Chinky Minky.mp4 | 2025-12-19 21:53 | 8.4M | |
| Communication Gap.mp4 | 2025-12-19 21:53 | 13M | |
| Depth of ocean.mp4 | 2025-12-19 21:53 | 1.6M | |
| Derh Hoshari.mp4 | 2025-12-19 21:53 | 767K | |
| Domestic Reverse Osm..> | 2025-12-19 21:53 | 12M | |
| East West Division a..> | 2025-12-19 21:53 | 10M | |
| Equator Effect.mp4 | 2025-12-19 21:53 | 13M | |
| Excellent parodies.mp4 | 2025-12-19 21:53 | 2.7M | |
| Exercise to Reset Yo..> | 2025-12-19 21:53 | 7.6M | |
| Farty.mp4 | 2025-12-19 21:53 | 1.5M | |
| Fawad Chaudhry Full ..> | 2025-12-19 21:53 | 95M | |
| Fawad Chaudhry Press..> | 2025-12-19 21:53 | 39M | |
| Fearlessness.mp4 | 2025-12-19 21:53 | 5.1M | |
| For Overseas Pakista..> | 2025-12-19 21:53 | 13M | |
| Freezing water.mp4 | 2025-12-19 21:53 | 814K | |
| Girl As Pilot.mp4 | 2025-12-19 21:53 | 1.3M | |
| Good Advice.mp4 | 2025-12-19 21:53 | 1.7M | |
| Good Foods.mp4 | 2025-12-19 21:53 | 1.8M | |
| Hai to Hai.mp4 | 2025-12-19 21:53 | 6.8M | |
| Hajj in 1953.mp4 | 2025-12-19 21:53 | 16M | |
| Hameed Gul on ISI.mp4 | 2025-12-19 21:53 | 934K | |
| Healthy Drinks.mp4 | 2025-12-19 21:54 | 15M | |
| Healthy foods.mp4 | 2025-12-19 21:54 | 9.5M | |
| Hindu on Islam.mp4 | 2025-12-19 21:54 | 7.2M | |
| How Sleep Quicker.mp4 | 2025-12-19 21:54 | 25M | |
| How to remain Health..> | 2025-12-19 21:54 | 13M | |
| Huma Qureshi and Naw..> | 2025-12-19 21:54 | 2.4M | |
| Ilaj by Food- Tariq ..> | 2025-12-19 21:54 | 8.4M | |
| Imran Khan About Mis..> | 2025-12-19 21:54 | 16M | |
| Indian Team Kit.mp4 | 2025-12-19 21:54 | 8.9M | |
| Information about CN..> | 2025-12-19 21:54 | 1.6M | |
| Isha in Northern Hem..> | 2025-12-19 21:54 | 44M | |
| Iskay Agay Ki Daasta..> | 2025-12-19 21:54 | 3.0M | |
| Islam in Korea.mp4 | 2025-12-19 21:54 | 22M | |
| Jab Barish Hoti Hai.mp4 | 2025-12-19 21:54 | 592K | |
| Japanese restaurant ..> | 2025-12-19 21:54 | 10M | |
| Jashn-e-Reekhta.mp4 | 2025-12-19 21:54 | 14M | |
| Jazba by Ali Zafar -..> | 2025-12-19 21:54 | 9.3M | |
| Jokes About Marketin..> | 2025-12-19 21:54 | 11M | |
| Justice system.mp4 | 2025-12-19 21:54 | 8.5M | |
| Karachi Foods.mp4 | 2025-12-19 21:54 | 15M | |
| Karam Yafta Log.mp4 | 2025-12-19 21:54 | 14M | |
| Kashmit Jihad.mp4 | 2025-12-19 21:54 | 4.4M | |
| Kenwood Ad 1.mp4 | 2025-12-19 21:54 | 9.1M | |
| Kenwood Ad 2.mp4 | 2025-12-19 21:54 | 1.4M | |
| Kenwood Ad 3.mp4 | 2025-12-19 21:55 | 10M | |
| Kenwood Ad 4.mp4 | 2025-12-19 21:55 | 14M | |
| Kenwood Ad 5.mp4 | 2025-12-19 21:55 | 8.5M | |
| Knee Treatment.mp4 | 2025-12-19 21:55 | 7.3M | |
| Laural or Yanny.mp4 | 2025-12-19 21:55 | 1.1M | |
| Legal Logical.mp4 | 2025-12-19 21:55 | 10M | |
| Lessons from African..> | 2025-12-19 21:55 | 23M | |
| Lessons from Eagle.mp4 | 2025-12-19 21:55 | 3.0M | |
| Life in Space.mp4 | 2025-12-19 21:55 | 13M | |
| Loving Friend.mp4 | 2025-12-19 21:55 | 1.9M | |
| Lung Test.mp4 | 2025-12-19 21:55 | 2.0M | |
| Makkah and Madina Az..> | 2025-12-19 21:55 | 1.9M | |
| Mansoor Ahmed at Gra..> | 2025-12-19 21:57 | 461M | |
| Mansoor Ahmed at Hum..> | 2025-12-19 21:55 | 31M | |
| Mansoor Ahmed at Ski..> | 2025-12-19 21:56 | 113M | |
| Mansoor Facebook Cli..> | 2025-12-19 21:56 | 2.2M | |
| Mansoor Paragliding ..> | 2025-12-19 21:56 | 95M | |
| Mansoor Vote Video.mp4 | 2025-12-19 21:56 | 5.9M | |
| Mansoor in CNBC News..> | 2025-12-19 21:56 | 24M | |
| Marwat about Khatak.mp4 | 2025-12-19 21:56 | 3.9M | |
| Maulana Tariq Jameel..> | 2025-12-19 21:57 | 3.5M | |
| Maulana Tariq Jameel..> | 2025-12-19 21:57 | 14M | |
| Maulana Tariq Jameel..> | 2025-12-19 21:57 | 34M | |
| Maulana Tariq Jameel..> | 2025-12-19 21:57 | 26M | |
| Mazar by Maulana Noo..> | 2025-12-19 21:57 | 2.6M | |
| Mehmaan Nawazi.mp4 | 2025-12-19 21:57 | 946K | |
| MeraFM live app intr..> | 2025-12-19 21:57 | 8.1M | |
| Messi goals.mp4 | 2025-12-19 21:57 | 19M | |
| Mind Reading.mp4 | 2025-12-19 21:57 | 517K | |
| Moat ka Kuwan.mp4 | 2025-12-19 21:57 | 9.0M | |
| Mufti Taqi Usmani Is..> | 2025-12-19 21:57 | 23M | |
| Nadbai in News.mp4 | 2025-12-19 21:57 | 48M | |
| Naeem Bukhari About ..> | 2025-12-19 21:57 | 5.8M | |
| Naufil for M2.mp4 | 2025-12-19 21:57 | 2.8M | |
| Old Computers.mp4 | 2025-12-19 21:57 | 4.6M | |
| Old Madina.mp4 | 2025-12-19 21:57 | 12M | |
| One Day Pilot Progra..> | 2025-12-19 21:58 | 119M | |
| Pakistan Old Currenc..> | 2025-12-19 21:58 | 42M | |
| Papeeta Laylo.mp4 | 2025-12-19 21:58 | 1.3M | |
| Parody 1.mp4 | 2025-12-19 21:58 | 12M | |
| Parody 2.mp4 | 2025-12-19 21:58 | 2.8M | |
| Parody 3.mp4 | 2025-12-19 21:58 | 10M | |
| Parody 4.mp4 | 2025-12-19 21:58 | 9.2M | |
| Parody 5.mp4 | 2025-12-19 21:58 | 5.4M | |
| Parody 6.mp4 | 2025-12-19 21:58 | 9.2M | |
| Parody 7.mp4 | 2025-12-19 21:58 | 9.5M | |
| Parody 8 Gavaskar on..> | 2025-12-19 21:58 | 12M | |
| Peoples Party Song o..> | 2025-12-19 21:58 | 2.9M | |
| Plane Takeoff Scene ..> | 2025-12-19 21:58 | 5.0M | |
| Pychological tricks.mp4 | 2025-12-19 21:58 | 3.9M | |
| RO Plant Presentatio..> | 2025-12-19 21:58 | 17M | |
| Raag Cat.mp4 | 2025-12-19 21:58 | 232K | |
| Raju Shrivastav Come..> | 2025-12-19 21:58 | 11M | |
| Ring Removal from Fi..> | 2025-12-19 21:58 | 3.2M | |
| Sand Artist.mp4 | 2025-12-19 21:58 | 2.3M | |
| Sanjay Dutt Entry Dh..> | 2025-12-23 10:34 | 93M | |
| Sardi style.mp4 | 2025-12-19 21:58 | 2.3M | |
| Scene Band Baaja Baa..> | 2025-12-19 21:59 | 33M | |
| Scene from Rangeela.mp4 | 2025-12-19 21:59 | 14M | |
| Sensations.mp4 | 2025-12-19 21:59 | 2.9M | |
| Shajrae Nabi.mp4 | 2025-12-19 21:59 | 8.0M | |
| Sheesha Nahi Faulad ..> | 2025-12-19 21:59 | 1.4M | |
| Shukar for Compariso..> | 2025-12-19 21:59 | 2.0M | |
| Sidra for M2.mp4 | 2025-12-19 21:59 | 2.7M | |
| Sila for M2.mp4 | 2025-12-19 21:59 | 7.1M | |
| Sky Lightening Effec..> | 2025-12-19 21:59 | 2.5M | |
| Snow Cleaning.mp4 | 2025-12-19 21:59 | 9.3M | |
| Swimming not Drownin..> | 2025-12-19 21:59 | 9.5M | |
| The Smell of the Pla..> | 2025-12-19 21:59 | 21M | |
| Tools We Want You to..> | 2025-12-19 21:59 | 23M | |
| Tribute to Dilip Kum..> | 2025-12-19 21:59 | 8.2M | |
| Tricky Sports.mp4 | 2025-12-19 21:59 | 22M | |
| Tumhi Mere Mandir.mp4 | 2025-12-19 21:59 | 10M | |
| US Bills.mp4 | 2025-12-19 21:59 | 7.4M | |
| Umar Shareef Kahana ..> | 2025-12-19 21:59 | 15M | |
| Vicks uses.mp4 | 2025-12-19 21:59 | 9.2M | |
| Virtual Airport .mp4 | 2025-12-19 21:59 | 1.8M | |
| Virtual Airport.mp4 | 2025-12-19 21:59 | 14M | |
| Virtual Airport 2.mp4 | 2025-12-19 21:59 | 5.3M | |
| Virtual Hair Cut.mp4 | 2025-12-19 21:59 | 7.0M | |
| WD40.mp4 | 2025-12-19 21:59 | 2.3M | |
| Wadi Jin Madina.mp4 | 2025-12-19 21:59 | 3.5M | |
| We see only others.mp4 | 2025-12-19 21:59 | 3.6M | |
| What People Do With ..> | 2025-12-19 21:59 | 485K | |
| Why man marry.mp4 | 2025-12-19 21:59 | 4.2M | |
| Women Language Trans..> | 2025-12-19 21:59 | 2.7M | |
| Wrong Salary Compari..> | 2025-12-19 22:00 | 8.1M | |
| Your Value At Compan..> | 2025-12-19 22:00 | 12M | |
| ZamZam Well.mp4 | 2025-12-19 22:00 | 2.9M | |
| iPhone se tafreeh.mp4 | 2025-12-19 21:54 | 8.2M | |
| lush engineering mus..> | 2025-12-19 21:55 | 12M | |
| miniature wonderland..> | 2025-12-19 21:57 | 13M | |
| raju srivastav film ..> | 2025-12-19 21:58 | 11M | |
| sync.ffs_db | 2025-12-24 11:02 | 3.0K | |